C10H16OS — CID 89303417
(2E)-2-[(E)-2-methylbut-1-enyl]sulfanylpenta-2,4-dien-1-ol (PubChem CID 89303417) has the molecular formula C10H16OS and a molecular weight of 184.30 g/mol. Its IUPAC name is (2E)-2-[(E)-2-methylbut-1-enyl]sulfanylpenta-2,4-dien-1-ol.
| Compound Name | (2E)-2-[(E)-2-methylbut-1-enyl]sulfanylpenta-2,4-dien-1-ol |
|---|---|
| PubChem CID | 89303417 |
| Molecular Formula | C10H16OS |
| Molecular Weight | 184.30 g/mol |
| Exact Mass | 184.09 |
| IUPAC Name | (2E)-2-[(E)-2-methylbut-1-enyl]sulfanylpenta-2,4-dien-1-ol |
| SMILES | C=C/C=C(\CO)S/C=C(\C)CC |
| InChI | InChI=1S/C10H16OS/c1-4-6-10(7-11)12-8-9(3)5-2/h4,6,8,11H,1,5,7H2,2-3H3/b9-8+,10-6+ |
| InChIKey | VUFBPPFTYUKZHA-JSAGYHNASA-N |
| XLogP | 3.10 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.30 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|