C11H16OS — CID 89416532
(Z)-2-[(3Z)-hexa-1,3,5-trien-2-yl]sulfanylpent-2-en-1-ol (PubChem CID 89416532) has the molecular formula C11H16OS and a molecular weight of 196.31 g/mol. Its IUPAC name is (Z)-2-[(3Z)-hexa-1,3,5-trien-2-yl]sulfanylpent-2-en-1-ol.
| Compound Name | (Z)-2-[(3Z)-hexa-1,3,5-trien-2-yl]sulfanylpent-2-en-1-ol |
|---|---|
| PubChem CID | 89416532 |
| Molecular Formula | C11H16OS |
| Molecular Weight | 196.31 g/mol |
| Exact Mass | 196.09 |
| IUPAC Name | (Z)-2-[(3Z)-hexa-1,3,5-trien-2-yl]sulfanylpent-2-en-1-ol |
| SMILES | C=C/C=C\C(=C)S/C(=C\CC)CO |
| InChI | InChI=1S/C11H16OS/c1-4-6-8-10(3)13-11(9-12)7-5-2/h4,6-8,12H,1,3,5,9H2,2H3/b8-6-,11-7- |
| InChIKey | XBPQCSUECPRLTG-NFNKYSHCSA-N |
| XLogP | 3.26 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.31 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|