C8H16OS — CID 14364618
(E,4R)-4-propan-2-ylsulfanylpent-2-en-1-ol (PubChem CID 14364618) has the molecular formula C8H16OS and a molecular weight of 160.28 g/mol. Its IUPAC name is (E,4R)-4-propan-2-ylsulfanylpent-2-en-1-ol.
| Compound Name | (E,4R)-4-propan-2-ylsulfanylpent-2-en-1-ol |
|---|---|
| PubChem CID | 14364618 |
| Molecular Formula | C8H16OS |
| Molecular Weight | 160.28 g/mol |
| Exact Mass | 160.09 |
| IUPAC Name | (E,4R)-4-propan-2-ylsulfanylpent-2-en-1-ol |
| SMILES | CC(C)S[C@H](C)/C=C/CO |
| InChI | InChI=1S/C8H16OS/c1-7(2)10-8(3)5-4-6-9/h4-5,7-9H,6H2,1-3H3/b5-4+/t8-/m1/s1 |
| InChIKey | JJDBUQSICACPPM-WTSVBCDHSA-N |
| XLogP | 2.07 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.28 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|