C13H22OS — CID 14709892
(6E)-2-methyl-4-methylidene-3-methylsulfanyldeca-2,6-dien-5-ol (PubChem CID 14709892) has the molecular formula C13H22OS and a molecular weight of 226.38 g/mol. Its IUPAC name is (6E)-2-methyl-4-methylidene-3-methylsulfanyldeca-2,6-dien-5-ol.
| Compound Name | (6E)-2-methyl-4-methylidene-3-methylsulfanyldeca-2,6-dien-5-ol |
|---|---|
| PubChem CID | 14709892 |
| Molecular Formula | C13H22OS |
| Molecular Weight | 226.38 g/mol |
| Exact Mass | 226.14 |
| IUPAC Name | (6E)-2-methyl-4-methylidene-3-methylsulfanyldeca-2,6-dien-5-ol |
| SMILES | C=C(C(SC)=C(C)C)C(O)/C=C/CCC |
| InChI | InChI=1S/C13H22OS/c1-6-7-8-9-12(14)11(4)13(15-5)10(2)3/h8-9,12,14H,4,6-7H2,1-3,5H3/b9-8+ |
| InChIKey | LYIKVUJSDKDDHJ-CMDGGOBGSA-N |
| XLogP | 3.92 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.38 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|