About (4-methylsulfanylcyclohexa-1,3-dien-1-yl)methanol
(4-methylsulfanylcyclohexa-1,3-dien-1-yl)methanol (PubChem CID 143175776) has the molecular formula C8H12OS
and a molecular weight of 156.25 g/mol. Its IUPAC name is (4-methylsulfanylcyclohexa-1,3-dien-1-yl)methanol.
Analyze (4-methylsulfanylcyclohexa-1,3-dien-1-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methylsulfanylcyclohexa-1,3-dien-1-yl)methanol?
The IUPAC name of (4-methylsulfanylcyclohexa-1,3-dien-1-yl)methanol (CID 143175776) is (4-methylsulfanylcyclohexa-1,3-dien-1-yl)methanol.
What is the SMILES notation for (4-methylsulfanylcyclohexa-1,3-dien-1-yl)methanol?
The canonical SMILES for (4-methylsulfanylcyclohexa-1,3-dien-1-yl)methanol is CSC1=CC=C(CO)CC1.
What is the InChIKey of (4-methylsulfanylcyclohexa-1,3-dien-1-yl)methanol?
The InChIKey is QVCSEOPVSHMAJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12OS/c1-10-8-4-2-7(6-9)3-5-8/h2,4,9H,3,5-6H2,1H3.
What are the key properties of (4-methylsulfanylcyclohexa-1,3-dien-1-yl)methanol?
(4-methylsulfanylcyclohexa-1,3-dien-1-yl)methanol has a molecular weight of 156.25 g/mol, XLogP of 1.95, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methylsulfanylcyclohexa-1,3-dien-1-yl)methanol is sourced from PubChem (CID 143175776), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).