C20H13ClN6S — CID 123903690
4-chloro-5-(1-methyl-4-pyridin-2-ylpyrrolo[3,2-c]pyridin-6-yl)-2-pyrimidin-5-yl-1,3-thiazole (PubChem CID 123903690) has the molecular formula C20H13ClN6S and a molecular weight of 404.89 g/mol. Its IUPAC name is 4-chloro-5-(1-methyl-4-pyridin-2-ylpyrrolo[3,2-c]pyridin-6-yl)-2-pyrimidin-5-yl-1,3-thiazole.
| Compound Name | 4-chloro-5-(1-methyl-4-pyridin-2-ylpyrrolo[3,2-c]pyridin-6-yl)-2-pyrimidin-5-yl-1,3-thiazole |
|---|---|
| PubChem CID | 123903690 |
| Molecular Formula | C20H13ClN6S |
| Molecular Weight | 404.89 g/mol |
| Exact Mass | 404.06 |
| IUPAC Name | 4-chloro-5-(1-methyl-4-pyridin-2-ylpyrrolo[3,2-c]pyridin-6-yl)-2-pyrimidin-5-yl-1,3-thiazole |
| SMILES | Cn1ccc2c(-c3ccccn3)nc(-c3sc(-c4cncnc4)nc3Cl)cc21 |
| InChI | InChI=1S/C20H13ClN6S/c1-27-7-5-13-16(27)8-15(25-17(13)14-4-2-3-6-24-14)18-19(21)26-20(28-18)12-9-22-11-23-10-12/h2-11H,1H3 |
| InChIKey | FLFGYYDZEGPVBH-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 69.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.89 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|