C28H14Cl2N8S2 — CID 144657133
2-(4-chloro-2-pyridin-3-yl-1,3-thiazol-5-yl)pyridine-3-carbonitrile (PubChem CID 144657133) has the molecular formula C28H14Cl2N8S2 and a molecular weight of 597.52 g/mol. Its IUPAC name is 2-(4-chloro-2-pyridin-3-yl-1,3-thiazol-5-yl)pyridine-3-carbonitrile.
| Compound Name | 2-(4-chloro-2-pyridin-3-yl-1,3-thiazol-5-yl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 144657133 |
| Molecular Formula | C28H14Cl2N8S2 |
| Molecular Weight | 597.52 g/mol |
| Exact Mass | 596.02 |
| IUPAC Name | 2-(4-chloro-2-pyridin-3-yl-1,3-thiazol-5-yl)pyridine-3-carbonitrile |
| SMILES | N#Cc1cccnc1-c1sc(-c2cccnc2)nc1Cl.N#Cc1cccnc1-c1sc(-c2cccnc2)nc1Cl |
| InChI | InChI=1S/2C14H7ClN4S/c2*15-13-12(11-9(7-16)3-2-6-18-11)20-14(19-13)10-4-1-5-17-8-10/h2*1-6,8H |
| InChIKey | UOKMMSAAXRRFIL-UHFFFAOYSA-N |
| XLogP | 7.58 |
| TPSA | 124.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.52 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |