C13H22N2O — CID 123903691
2,3-dimethyl-N'-(oxolan-3-yl)-N-prop-1-en-2-ylbut-2-enimidamide (PubChem CID 123903691) has the molecular formula C13H22N2O and a molecular weight of 222.33 g/mol. Its IUPAC name is 2,3-dimethyl-N'-(oxolan-3-yl)-N-prop-1-en-2-ylbut-2-enimidamide.
| Compound Name | 2,3-dimethyl-N'-(oxolan-3-yl)-N-prop-1-en-2-ylbut-2-enimidamide |
|---|---|
| PubChem CID | 123903691 |
| Molecular Formula | C13H22N2O |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.17 |
| IUPAC Name | 2,3-dimethyl-N'-(oxolan-3-yl)-N-prop-1-en-2-ylbut-2-enimidamide |
| SMILES | C=C(C)N/C(=N/C1CCOC1)C(C)=C(C)C |
| InChI | InChI=1S/C13H22N2O/c1-9(2)11(5)13(14-10(3)4)15-12-6-7-16-8-12/h12H,3,6-8H2,1-2,4-5H3,(H,14,15) |
| InChIKey | MFLBPMQDXVOGQV-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|