C12H20N2 — CID 123904438
5-butan-2-yl-6-[(Z)-but-1-enyl]-2,3-dihydropyrazine (PubChem CID 123904438) has the molecular formula C12H20N2 and a molecular weight of 192.31 g/mol. Its IUPAC name is 5-butan-2-yl-6-[(Z)-but-1-enyl]-2,3-dihydropyrazine.
| Compound Name | 5-butan-2-yl-6-[(Z)-but-1-enyl]-2,3-dihydropyrazine |
|---|---|
| PubChem CID | 123904438 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | 5-butan-2-yl-6-[(Z)-but-1-enyl]-2,3-dihydropyrazine |
| SMILES | CC/C=C\C1=NCCN=C1C(C)CC |
| InChI | InChI=1S/C12H20N2/c1-4-6-7-11-12(10(3)5-2)14-9-8-13-11/h6-7,10H,4-5,8-9H2,1-3H3/b7-6- |
| InChIKey | BHYIWMNBIKEDFD-SREVYHEPSA-N |
| XLogP | 2.89 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |