C15H29NO3S — CID 123906190
tert-butyl 4-(butylsulfanylmethyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylate (PubChem CID 123906190) has the molecular formula C15H29NO3S and a molecular weight of 303.47 g/mol. Its IUPAC name is tert-butyl 4-(butylsulfanylmethyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl 4-(butylsulfanylmethyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 123906190 |
| Molecular Formula | C15H29NO3S |
| Molecular Weight | 303.47 g/mol |
| Exact Mass | 303.19 |
| IUPAC Name | tert-butyl 4-(butylsulfanylmethyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
| SMILES | CCCCSCC1COC(C)(C)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H29NO3S/c1-7-8-9-20-11-12-10-18-15(5,6)16(12)13(17)19-14(2,3)4/h12H,7-11H2,1-6H3 |
| InChIKey | ZNWCQLZLAULYCP-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.47 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|