C10H15N — CID 123906787
6-[(Z)-but-1-enyl]-3-methyl-3,4-dihydropyridine (PubChem CID 123906787) has the molecular formula C10H15N and a molecular weight of 149.24 g/mol. Its IUPAC name is 6-[(Z)-but-1-enyl]-3-methyl-3,4-dihydropyridine.
| Compound Name | 6-[(Z)-but-1-enyl]-3-methyl-3,4-dihydropyridine |
|---|---|
| PubChem CID | 123906787 |
| Molecular Formula | C10H15N |
| Molecular Weight | 149.24 g/mol |
| Exact Mass | 149.12 |
| IUPAC Name | 6-[(Z)-but-1-enyl]-3-methyl-3,4-dihydropyridine |
| SMILES | CC/C=C\C1=CCC(C)C=N1 |
| InChI | InChI=1S/C10H15N/c1-3-4-5-10-7-6-9(2)8-11-10/h4-5,7-9H,3,6H2,1-2H3/b5-4- |
| InChIKey | AEIBMDLWWVPIFX-PLNGDYQASA-N |
| XLogP | 2.95 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.24 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |