C15H26F2O — CID 123906972
3-(1,1-difluoro-2-heptoxyethyl)hexa-2,4-diene (PubChem CID 123906972) has the molecular formula C15H26F2O and a molecular weight of 260.37 g/mol. Its IUPAC name is 3-(1,1-difluoro-2-heptoxyethyl)hexa-2,4-diene.
| Compound Name | 3-(1,1-difluoro-2-heptoxyethyl)hexa-2,4-diene |
|---|---|
| PubChem CID | 123906972 |
| Molecular Formula | C15H26F2O |
| Molecular Weight | 260.37 g/mol |
| Exact Mass | 260.20 |
| IUPAC Name | 3-(1,1-difluoro-2-heptoxyethyl)hexa-2,4-diene |
| SMILES | CC=CC(=CC)C(F)(F)COCCCCCCC |
| InChI | InChI=1S/C15H26F2O/c1-4-7-8-9-10-12-18-13-15(16,17)14(6-3)11-5-2/h5-6,11H,4,7-10,12-13H2,1-3H3 |
| InChIKey | YHZOHUXMHSKHOC-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.37 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|