About (2-oxo-1-phenylethenyl) 2-formyloxy-2-[2-[(4-methoxyphenyl)methyl]phenyl]acetate
(2-oxo-1-phenylethenyl) 2-formyloxy-2-[2-[(4-methoxyphenyl)methyl]phenyl]acetate (PubChem CID 123909517) has the molecular formula C25H20O6
and a molecular weight of 416.43 g/mol. Its IUPAC name is (2-oxo-1-phenylethenyl) 2-formyloxy-2-[2-[(4-methoxyphenyl)methyl]phenyl]acetate.
Molecular Properties
| Compound Name | (2-oxo-1-phenylethenyl) 2-formyloxy-2-[2-[(4-methoxyphenyl)methyl]phenyl]acetate |
| PubChem CID | 123909517 |
| Molecular Formula | C25H20O6 |
| Molecular Weight | 416.43 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | (2-oxo-1-phenylethenyl) 2-formyloxy-2-[2-[(4-methoxyphenyl)methyl]phenyl]acetate |
| SMILES | COc1ccc(Cc2ccccc2C(OC=O)C(=O)OC(=C=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C25H20O6/c1-29-21-13-11-18(12-14-21)15-20-9-5-6-10-22(20)24(30-17-27)25(28)31-23(16-26)19-7-3-2-4-8-19/h2-14,17,24H,15H2,1H3 |
| InChIKey | GZYNLQRDRPWBLG-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 416.43 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|
Analyze (2-oxo-1-phenylethenyl) 2-formyloxy-2-[2-[(4-methoxyphenyl)methyl]phenyl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-oxo-1-phenylethenyl) 2-formyloxy-2-[2-[(4-methoxyphenyl)methyl]phenyl]acetate?
The IUPAC name of (2-oxo-1-phenylethenyl) 2-formyloxy-2-[2-[(4-methoxyphenyl)methyl]phenyl]acetate (CID 123909517) is (2-oxo-1-phenylethenyl) 2-formyloxy-2-[2-[(4-methoxyphenyl)methyl]phenyl]acetate.
What is the SMILES notation for (2-oxo-1-phenylethenyl) 2-formyloxy-2-[2-[(4-methoxyphenyl)methyl]phenyl]acetate?
The canonical SMILES for (2-oxo-1-phenylethenyl) 2-formyloxy-2-[2-[(4-methoxyphenyl)methyl]phenyl]acetate is COc1ccc(Cc2ccccc2C(OC=O)C(=O)OC(=C=O)c2ccccc2)cc1.
What is the InChIKey of (2-oxo-1-phenylethenyl) 2-formyloxy-2-[2-[(4-methoxyphenyl)methyl]phenyl]acetate?
The InChIKey is GZYNLQRDRPWBLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H20O6/c1-29-21-13-11-18(12-14-21)15-20-9-5-6-10-22(20)24(30-17-27)25(28)31-23(16-26)19-7-3-2-4-8-19/h2-14,17,24H,15H2,1H3.
What are the key properties of (2-oxo-1-phenylethenyl) 2-formyloxy-2-[2-[(4-methoxyphenyl)methyl]phenyl]acetate?
(2-oxo-1-phenylethenyl) 2-formyloxy-2-[2-[(4-methoxyphenyl)methyl]phenyl]acetate has a molecular weight of 416.43 g/mol, XLogP of 3.92, 9 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2-oxo-1-phenylethenyl) 2-formyloxy-2-[2-[(4-methoxyphenyl)methyl]phenyl]acetate is sourced from PubChem (CID 123909517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).