C28H23NO7 — CID 173340196
[1-(9H-fluoren-9-yl)-2-[(4-methoxyphenyl)methoxy]-2-oxoethyl] 3-cyano-2-formyloxypropanoate (PubChem CID 173340196) has the molecular formula C28H23NO7 and a molecular weight of 485.49 g/mol. Its IUPAC name is [1-(9H-fluoren-9-yl)-2-[(4-methoxyphenyl)methoxy]-2-oxoethyl] 3-cyano-2-formyloxypropanoate.
| Compound Name | [1-(9H-fluoren-9-yl)-2-[(4-methoxyphenyl)methoxy]-2-oxoethyl] 3-cyano-2-formyloxypropanoate |
|---|---|
| PubChem CID | 173340196 |
| Molecular Formula | C28H23NO7 |
| Molecular Weight | 485.49 g/mol |
| Exact Mass | 485.15 |
| IUPAC Name | [1-(9H-fluoren-9-yl)-2-[(4-methoxyphenyl)methoxy]-2-oxoethyl] 3-cyano-2-formyloxypropanoate |
| SMILES | COc1ccc(COC(=O)C(OC(=O)C(CC#N)OC=O)C2c3ccccc3-c3ccccc32)cc1 |
| InChI | InChI=1S/C28H23NO7/c1-33-19-12-10-18(11-13-19)16-34-28(32)26(36-27(31)24(14-15-29)35-17-30)25-22-8-4-2-6-20(22)21-7-3-5-9-23(21)25/h2-13,17,24-26H,14,16H2,1H3 |
| InChIKey | HRCOJFUFGNOHKG-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 111.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.49 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|