C40H47N6O4S2Si — CID 123909563
CID 123909563 (PubChem CID 123909563) has the molecular formula C40H47N6O4S2Si and a molecular weight of 768.07 g/mol.
| Compound Name | CID 123909563 |
|---|---|
| PubChem CID | 123909563 |
| Molecular Formula | C40H47N6O4S2Si |
| Molecular Weight | 768.07 g/mol |
| Exact Mass | 767.29 |
| IUPAC Name | — |
| SMILES | CSC1(c2ncc(-c3ccc4cc(-c5ccc6nc(NCC7([Si])CCCN7C(=O)OC(C)(C)C)sc6c5)ccc4c3)[nH]2)CCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C40H47N6O4S2Si/c1-37(2,3)49-35(47)45-18-8-16-39(45,53)24-42-34-44-30-15-14-28(22-32(30)52-34)26-10-11-27-21-29(13-12-25(27)20-26)31-23-41-33(43-31)40(51-7)17-9-19-46(40)36(48)50-38(4,5)6/h10-15,20-23H,8-9,16-19,24H2,1-7H3,(H,41,43)(H,42,44) |
| InChIKey | SZKKFHKRLYYJKH-UHFFFAOYSA-N |
| XLogP | 9.36 |
| TPSA | 112.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 768.07 |
| LogP ≤ 5 | 9.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|