C19H35N — CID 123910730
3,8-dimethyl-5-(2-methylbutyl)dodeca-5,11-dien-2-imine (PubChem CID 123910730) has the molecular formula C19H35N and a molecular weight of 277.50 g/mol. Its IUPAC name is 3,8-dimethyl-5-(2-methylbutyl)dodeca-5,11-dien-2-imine.
| Compound Name | 3,8-dimethyl-5-(2-methylbutyl)dodeca-5,11-dien-2-imine |
|---|---|
| PubChem CID | 123910730 |
| Molecular Formula | C19H35N |
| Molecular Weight | 277.50 g/mol |
| Exact Mass | 277.28 |
| IUPAC Name | 3,8-dimethyl-5-(2-methylbutyl)dodeca-5,11-dien-2-imine |
| SMILES | [H]/N=C(\C)C(C)CC(=CCC(C)CCC=C)CC(C)CC |
| InChI | InChI=1S/C19H35N/c1-7-9-10-16(4)11-12-19(13-15(3)8-2)14-17(5)18(6)20/h7,12,15-17,20H,1,8-11,13-14H2,2-6H3/b19-12?,20-18+ |
| InChIKey | NLEMWYZCXYAORB-NQNJEXPGSA-N |
| XLogP | 6.41 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.50 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|