C24H25N5O3S — CID 123912942
2-(7-methoxy-3-oxo-1H-isoindol-2-yl)-N-[4-(2,3,5,6-tetrahydro-1,4-diazepin-4-yl)-3-pyridinyl]-2,3-dihydrothiophene-5-carboxamide (PubChem CID 123912942) has the molecular formula C24H25N5O3S and a molecular weight of 463.56 g/mol. Its IUPAC name is 2-(7-methoxy-3-oxo-1H-isoindol-2-yl)-N-[4-(2,3,5,6-tetrahydro-1,4-diazepin-4-yl)-3-pyridinyl]-2,3-dihydrothiophene-5-carboxamide.
| Compound Name | 2-(7-methoxy-3-oxo-1H-isoindol-2-yl)-N-[4-(2,3,5,6-tetrahydro-1,4-diazepin-4-yl)-3-pyridinyl]-2,3-dihydrothiophene-5-carboxamide |
|---|---|
| PubChem CID | 123912942 |
| Molecular Formula | C24H25N5O3S |
| Molecular Weight | 463.56 g/mol |
| Exact Mass | 463.17 |
| IUPAC Name | 2-(7-methoxy-3-oxo-1H-isoindol-2-yl)-N-[4-(2,3,5,6-tetrahydro-1,4-diazepin-4-yl)-3-pyridinyl]-2,3-dihydrothiophene-5-carboxamide |
| SMILES | COc1cccc2c1CN(C1CC=C(C(=O)Nc3cnccc3N3CCC=NCC3)S1)C2=O |
| InChI | InChI=1S/C24H25N5O3S/c1-32-20-5-2-4-16-17(20)15-29(24(16)31)22-7-6-21(33-22)23(30)27-18-14-26-10-8-19(18)28-12-3-9-25-11-13-28/h2,4-6,8-10,14,22H,3,7,11-13,15H2,1H3,(H,27,30) |
| InChIKey | LKMKEXPLHGGIOF-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 87.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.56 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |