C20H21N5O4 — CID 123913046
(2R)-2-[(2-isocyano-3-nitrophenoxy)methyl]-N-(pyridin-4-ylmethyl)piperidine-1-carboxamide (PubChem CID 123913046) has the molecular formula C20H21N5O4 and a molecular weight of 395.42 g/mol. Its IUPAC name is (2R)-2-[(2-isocyano-3-nitrophenoxy)methyl]-N-(pyridin-4-ylmethyl)piperidine-1-carboxamide.
| Compound Name | (2R)-2-[(2-isocyano-3-nitrophenoxy)methyl]-N-(pyridin-4-ylmethyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 123913046 |
| Molecular Formula | C20H21N5O4 |
| Molecular Weight | 395.42 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | (2R)-2-[(2-isocyano-3-nitrophenoxy)methyl]-N-(pyridin-4-ylmethyl)piperidine-1-carboxamide |
| SMILES | [C-]#[N+]c1c(OC[C@H]2CCCCN2C(=O)NCc2ccncc2)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H21N5O4/c1-21-19-17(25(27)28)6-4-7-18(19)29-14-16-5-2-3-12-24(16)20(26)23-13-15-8-10-22-11-9-15/h4,6-11,16H,2-3,5,12-14H2,(H,23,26)/t16-/m1/s1 |
| InChIKey | MZKQAELRKZNJNC-MRXNPFEDSA-N |
| XLogP | 3.68 |
| TPSA | 101.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.42 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|