C22H30N2O4 — CID 123913429
ethyl 4-[[2-(7-methoxy-3-methylideneocta-4,6-dien-4-yl)cyclopropyl]methoxy]-2-methylpyrimidine-5-carboxylate (PubChem CID 123913429) has the molecular formula C22H30N2O4 and a molecular weight of 386.49 g/mol. Its IUPAC name is ethyl 4-[[2-(7-methoxy-3-methylideneocta-4,6-dien-4-yl)cyclopropyl]methoxy]-2-methylpyrimidine-5-carboxylate.
| Compound Name | ethyl 4-[[2-(7-methoxy-3-methylideneocta-4,6-dien-4-yl)cyclopropyl]methoxy]-2-methylpyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 123913429 |
| Molecular Formula | C22H30N2O4 |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.22 |
| IUPAC Name | ethyl 4-[[2-(7-methoxy-3-methylideneocta-4,6-dien-4-yl)cyclopropyl]methoxy]-2-methylpyrimidine-5-carboxylate |
| SMILES | C=C(CC)C(=CC=C(C)OC)C1CC1COc1nc(C)ncc1C(=O)OCC |
| InChI | InChI=1S/C22H30N2O4/c1-7-14(3)18(10-9-15(4)26-6)19-11-17(19)13-28-21-20(22(25)27-8-2)12-23-16(5)24-21/h9-10,12,17,19H,3,7-8,11,13H2,1-2,4-6H3 |
| InChIKey | JUGRLBBIXPLVTG-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 70.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|