C22H26Cl3FN2O4 — CID 123913797
N-[(E)-7-(4-benzyl-2-oxo-1,3-oxazolidin-3-yl)-4-fluoro-2,6-dimethyl-7-oxohept-5-en-3-yl]-2,2,2-trichloro-N-methylacetamide (PubChem CID 123913797) has the molecular formula C22H26Cl3FN2O4 and a molecular weight of 507.82 g/mol. Its IUPAC name is N-[(E)-7-(4-benzyl-2-oxo-1,3-oxazolidin-3-yl)-4-fluoro-2,6-dimethyl-7-oxohept-5-en-3-yl]-2,2,2-trichloro-N-methylacetamide.
| Compound Name | N-[(E)-7-(4-benzyl-2-oxo-1,3-oxazolidin-3-yl)-4-fluoro-2,6-dimethyl-7-oxohept-5-en-3-yl]-2,2,2-trichloro-N-methylacetamide |
|---|---|
| PubChem CID | 123913797 |
| Molecular Formula | C22H26Cl3FN2O4 |
| Molecular Weight | 507.82 g/mol |
| Exact Mass | 506.09 |
| IUPAC Name | N-[(E)-7-(4-benzyl-2-oxo-1,3-oxazolidin-3-yl)-4-fluoro-2,6-dimethyl-7-oxohept-5-en-3-yl]-2,2,2-trichloro-N-methylacetamide |
| SMILES | C/C(=C\C(F)C(C(C)C)N(C)C(=O)C(Cl)(Cl)Cl)C(=O)N1C(=O)OCC1Cc1ccccc1 |
| InChI | InChI=1S/C22H26Cl3FN2O4/c1-13(2)18(27(4)20(30)22(23,24)25)17(26)10-14(3)19(29)28-16(12-32-21(28)31)11-15-8-6-5-7-9-15/h5-10,13,16-18H,11-12H2,1-4H3/b14-10+ |
| InChIKey | LZUKXJRUXKERAK-GXDHUFHOSA-N |
| XLogP | 4.71 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.82 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|