C15H28O2Si — CID 123914409
2-(2-bicyclo[2.2.1]hept-5-enyl)ethyl-(2,2-diethoxyethyl)silane (PubChem CID 123914409) has the molecular formula C15H28O2Si and a molecular weight of 268.47 g/mol. Its IUPAC name is 2-(2-bicyclo[2.2.1]hept-5-enyl)ethyl-(2,2-diethoxyethyl)silane.
| Compound Name | 2-(2-bicyclo[2.2.1]hept-5-enyl)ethyl-(2,2-diethoxyethyl)silane |
|---|---|
| PubChem CID | 123914409 |
| Molecular Formula | C15H28O2Si |
| Molecular Weight | 268.47 g/mol |
| Exact Mass | 268.19 |
| IUPAC Name | 2-(2-bicyclo[2.2.1]hept-5-enyl)ethyl-(2,2-diethoxyethyl)silane |
| SMILES | CCOC(C[SiH2]CCC1CC2C=CC1C2)OCC |
| InChI | InChI=1S/C15H28O2Si/c1-3-16-15(17-4-2)11-18-8-7-14-10-12-5-6-13(14)9-12/h5-6,12-15H,3-4,7-11,18H2,1-2H3 |
| InChIKey | CIGZTIOQPHGKEC-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.47 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|