C14H28N2O — CID 123914747
2-(2-nonyl-4,5-dihydro-1H-imidazol-5-yl)ethanol (PubChem CID 123914747) has the molecular formula C14H28N2O and a molecular weight of 240.39 g/mol. Its IUPAC name is 2-(2-nonyl-4,5-dihydro-1H-imidazol-5-yl)ethanol.
| Compound Name | 2-(2-nonyl-4,5-dihydro-1H-imidazol-5-yl)ethanol |
|---|---|
| PubChem CID | 123914747 |
| Molecular Formula | C14H28N2O |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.22 |
| IUPAC Name | 2-(2-nonyl-4,5-dihydro-1H-imidazol-5-yl)ethanol |
| SMILES | CCCCCCCCCC1=NCC(CCO)N1 |
| InChI | InChI=1S/C14H28N2O/c1-2-3-4-5-6-7-8-9-14-15-12-13(16-14)10-11-17/h13,17H,2-12H2,1H3,(H,15,16) |
| InChIKey | ZSLBXZIQBSAWGG-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 44.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|