C12H24O4 — CID 123915036
(5S)-5-(2,2-diethoxyethoxy)hex-2-en-1-ol (PubChem CID 123915036) has the molecular formula C12H24O4 and a molecular weight of 232.32 g/mol. Its IUPAC name is (5S)-5-(2,2-diethoxyethoxy)hex-2-en-1-ol.
| Compound Name | (5S)-5-(2,2-diethoxyethoxy)hex-2-en-1-ol |
|---|---|
| PubChem CID | 123915036 |
| Molecular Formula | C12H24O4 |
| Molecular Weight | 232.32 g/mol |
| Exact Mass | 232.17 |
| IUPAC Name | (5S)-5-(2,2-diethoxyethoxy)hex-2-en-1-ol |
| SMILES | CCOC(CO[C@@H](C)CC=CCO)OCC |
| InChI | InChI=1S/C12H24O4/c1-4-14-12(15-5-2)10-16-11(3)8-6-7-9-13/h6-7,11-13H,4-5,8-10H2,1-3H3/t11-/m0/s1 |
| InChIKey | IUWFJFVVZGERMC-NSHDSACASA-N |
| XLogP | 1.73 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.32 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|