About (5S)-5-(2,2-diethoxyethoxy)hex-2-en-1-ol
(5S)-5-(2,2-diethoxyethoxy)hex-2-en-1-ol (PubChem CID 123915036) has the molecular formula C12H24O4
and a molecular weight of 232.32 g/mol. Its IUPAC name is (5S)-5-(2,2-diethoxyethoxy)hex-2-en-1-ol.
Molecular Properties
| Compound Name | (5S)-5-(2,2-diethoxyethoxy)hex-2-en-1-ol |
| PubChem CID | 123915036 |
| Molecular Formula | C12H24O4 |
| Molecular Weight | 232.32 g/mol |
| Exact Mass | 232.17 |
| IUPAC Name | (5S)-5-(2,2-diethoxyethoxy)hex-2-en-1-ol |
| SMILES | CCOC(CO[C@@H](C)CC=CCO)OCC |
| InChI | InChI=1S/C12H24O4/c1-4-14-12(15-5-2)10-16-11(3)8-6-7-9-13/h6-7,11-13H,4-5,8-10H2,1-3H3/t11-/m0/s1 |
| InChIKey | IUWFJFVVZGERMC-NSHDSACASA-N |
| XLogP | 1.73 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.32 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (5S)-5-(2,2-diethoxyethoxy)hex-2-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S)-5-(2,2-diethoxyethoxy)hex-2-en-1-ol?
The IUPAC name of (5S)-5-(2,2-diethoxyethoxy)hex-2-en-1-ol (CID 123915036) is (5S)-5-(2,2-diethoxyethoxy)hex-2-en-1-ol.
What is the SMILES notation for (5S)-5-(2,2-diethoxyethoxy)hex-2-en-1-ol?
The canonical SMILES for (5S)-5-(2,2-diethoxyethoxy)hex-2-en-1-ol is CCOC(CO[C@@H](C)CC=CCO)OCC.
What is the InChIKey of (5S)-5-(2,2-diethoxyethoxy)hex-2-en-1-ol?
The InChIKey is IUWFJFVVZGERMC-NSHDSACASA-N. The full InChI is InChI=1S/C12H24O4/c1-4-14-12(15-5-2)10-16-11(3)8-6-7-9-13/h6-7,11-13H,4-5,8-10H2,1-3H3/t11-/m0/s1.
What are the key properties of (5S)-5-(2,2-diethoxyethoxy)hex-2-en-1-ol?
(5S)-5-(2,2-diethoxyethoxy)hex-2-en-1-ol has a molecular weight of 232.32 g/mol, XLogP of 1.73, 10 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5S)-5-(2,2-diethoxyethoxy)hex-2-en-1-ol is sourced from PubChem (CID 123915036), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).