C8H14N6 — CID 123915713
1-methyl-2-(N'-methylcarbamimidoyl)-1-(1H-pyrrol-2-yl)guanidine (PubChem CID 123915713) has the molecular formula C8H14N6 and a molecular weight of 194.24 g/mol. Its IUPAC name is 1-methyl-2-(N'-methylcarbamimidoyl)-1-(1H-pyrrol-2-yl)guanidine.
| Compound Name | 1-methyl-2-(N'-methylcarbamimidoyl)-1-(1H-pyrrol-2-yl)guanidine |
|---|---|
| PubChem CID | 123915713 |
| Molecular Formula | C8H14N6 |
| Molecular Weight | 194.24 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | 1-methyl-2-(N'-methylcarbamimidoyl)-1-(1H-pyrrol-2-yl)guanidine |
| SMILES | C/N=C(\N)N=C(N)N(C)c1ccc[nH]1 |
| InChI | InChI=1S/C8H14N6/c1-11-7(9)13-8(10)14(2)6-4-3-5-12-6/h3-5,12H,1-2H3,(H4,9,10,11,13) |
| InChIKey | WBTAVPRFNRBJMX-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 95.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.24 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|