C12H24N4 — CID 123915938
N'-[4-(aminomethylimino)cyclohex-2-en-1-yl]-N,N,N'-trimethylethane-1,2-diamine (PubChem CID 123915938) has the molecular formula C12H24N4 and a molecular weight of 224.35 g/mol. Its IUPAC name is N'-[4-(aminomethylimino)cyclohex-2-en-1-yl]-N,N,N'-trimethylethane-1,2-diamine.
| Compound Name | N'-[4-(aminomethylimino)cyclohex-2-en-1-yl]-N,N,N'-trimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 123915938 |
| Molecular Formula | C12H24N4 |
| Molecular Weight | 224.35 g/mol |
| Exact Mass | 224.20 |
| IUPAC Name | N'-[4-(aminomethylimino)cyclohex-2-en-1-yl]-N,N,N'-trimethylethane-1,2-diamine |
| SMILES | CN(C)CCN(C)C1C=CC(=NCN)CC1 |
| InChI | InChI=1S/C12H24N4/c1-15(2)8-9-16(3)12-6-4-11(5-7-12)14-10-13/h4,6,12H,5,7-10,13H2,1-3H3 |
| InChIKey | JEKLSDBPIMOHNO-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 44.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.35 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|