C12H22N2 — CID 163892273
6-[(Z)-but-1-enyl]-5-methyl-2-propyl-1,2,3,6-tetrahydropyrazine (PubChem CID 163892273) has the molecular formula C12H22N2 and a molecular weight of 194.32 g/mol. Its IUPAC name is 6-[(Z)-but-1-enyl]-5-methyl-2-propyl-1,2,3,6-tetrahydropyrazine.
| Compound Name | 6-[(Z)-but-1-enyl]-5-methyl-2-propyl-1,2,3,6-tetrahydropyrazine |
|---|---|
| PubChem CID | 163892273 |
| Molecular Formula | C12H22N2 |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.18 |
| IUPAC Name | 6-[(Z)-but-1-enyl]-5-methyl-2-propyl-1,2,3,6-tetrahydropyrazine |
| SMILES | CC/C=C\C1NC(CCC)CN=C1C |
| InChI | InChI=1S/C12H22N2/c1-4-6-8-12-10(3)13-9-11(14-12)7-5-2/h6,8,11-12,14H,4-5,7,9H2,1-3H3/b8-6- |
| InChIKey | QCNROSAZDSIPPC-VURMDHGXSA-N |
| XLogP | 2.55 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|