About 4-butyl-2-methylpyrrolo[2,3-d]pyrimidin-7-ium
4-butyl-2-methylpyrrolo[2,3-d]pyrimidin-7-ium (PubChem CID 123919130) has the molecular formula C11H14N3+
and a molecular weight of 188.25 g/mol. Its IUPAC name is 4-butyl-2-methylpyrrolo[2,3-d]pyrimidin-7-ium.
Molecular Properties
| Compound Name | 4-butyl-2-methylpyrrolo[2,3-d]pyrimidin-7-ium |
| PubChem CID | 123919130 |
| Molecular Formula | C11H14N3+ |
| Molecular Weight | 188.25 g/mol |
| Exact Mass | 188.12 |
| IUPAC Name | 4-butyl-2-methylpyrrolo[2,3-d]pyrimidin-7-ium |
| SMILES | CCCCc1nc(C)nc2c1=CC=[N+]=2 |
| InChI | InChI=1S/C11H14N3/c1-3-4-5-10-9-6-7-12-11(9)14-8(2)13-10/h6-7H,3-5H2,1-2H3/q+1 |
| InChIKey | VUYJHCBXIXWXPO-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 39.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.25 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 4-butyl-2-methylpyrrolo[2,3-d]pyrimidin-7-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-butyl-2-methylpyrrolo[2,3-d]pyrimidin-7-ium?
The IUPAC name of 4-butyl-2-methylpyrrolo[2,3-d]pyrimidin-7-ium (CID 123919130) is 4-butyl-2-methylpyrrolo[2,3-d]pyrimidin-7-ium.
What is the SMILES notation for 4-butyl-2-methylpyrrolo[2,3-d]pyrimidin-7-ium?
The canonical SMILES for 4-butyl-2-methylpyrrolo[2,3-d]pyrimidin-7-ium is CCCCc1nc(C)nc2c1=CC=[N+]=2.
What is the InChIKey of 4-butyl-2-methylpyrrolo[2,3-d]pyrimidin-7-ium?
The InChIKey is VUYJHCBXIXWXPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N3/c1-3-4-5-10-9-6-7-12-11(9)14-8(2)13-10/h6-7H,3-5H2,1-2H3/q+1.
What are the key properties of 4-butyl-2-methylpyrrolo[2,3-d]pyrimidin-7-ium?
4-butyl-2-methylpyrrolo[2,3-d]pyrimidin-7-ium has a molecular weight of 188.25 g/mol, XLogP of -0.32, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-butyl-2-methylpyrrolo[2,3-d]pyrimidin-7-ium is sourced from PubChem (CID 123919130), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).