About 2,4-diazatricyclo[7.3.0.03,7]dodeca-1(9),2,4,6-tetraene
2,4-diazatricyclo[7.3.0.03,7]dodeca-1(9),2,4,6-tetraene (PubChem CID 141055039) has the molecular formula C10H10N2
and a molecular weight of 158.20 g/mol. Its IUPAC name is 2,4-diazatricyclo[7.3.0.03,7]dodeca-1(9),2,4,6-tetraene.
Analyze 2,4-diazatricyclo[7.3.0.03,7]dodeca-1(9),2,4,6-tetraene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-diazatricyclo[7.3.0.03,7]dodeca-1(9),2,4,6-tetraene?
The IUPAC name of 2,4-diazatricyclo[7.3.0.03,7]dodeca-1(9),2,4,6-tetraene (CID 141055039) is 2,4-diazatricyclo[7.3.0.03,7]dodeca-1(9),2,4,6-tetraene.
What is the SMILES notation for 2,4-diazatricyclo[7.3.0.03,7]dodeca-1(9),2,4,6-tetraene?
The canonical SMILES for 2,4-diazatricyclo[7.3.0.03,7]dodeca-1(9),2,4,6-tetraene is C1=NC2=NC3=C(CCC3)CC2=C1.
What is the InChIKey of 2,4-diazatricyclo[7.3.0.03,7]dodeca-1(9),2,4,6-tetraene?
The InChIKey is GJGCHRUVOFRERW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2/c1-2-7-6-8-4-5-11-10(8)12-9(7)3-1/h4-5H,1-3,6H2.
What are the key properties of 2,4-diazatricyclo[7.3.0.03,7]dodeca-1(9),2,4,6-tetraene?
2,4-diazatricyclo[7.3.0.03,7]dodeca-1(9),2,4,6-tetraene has a molecular weight of 158.20 g/mol, XLogP of 2.24, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-diazatricyclo[7.3.0.03,7]dodeca-1(9),2,4,6-tetraene is sourced from PubChem (CID 141055039), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).