About 4,6,7,8-tetrahydroquinazoline
4,6,7,8-tetrahydroquinazoline (PubChem CID 175263259) has the molecular formula C8H10N2
and a molecular weight of 134.18 g/mol. Its IUPAC name is 4,6,7,8-tetrahydroquinazoline.
Molecular Properties
| Compound Name | 4,6,7,8-tetrahydroquinazoline |
| PubChem CID | 175263259 |
| Molecular Formula | C8H10N2 |
| Molecular Weight | 134.18 g/mol |
| Exact Mass | 134.08 |
| IUPAC Name | 4,6,7,8-tetrahydroquinazoline |
| SMILES | C1=NCC2=CCCCC2=N1 |
| InChI | InChI=1S/C8H10N2/c1-2-4-8-7(3-1)5-9-6-10-8/h3,6H,1-2,4-5H2 |
| InChIKey | IOLPYJJNSQNNMX-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.18 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4,6,7,8-tetrahydroquinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,6,7,8-tetrahydroquinazoline?
The IUPAC name of 4,6,7,8-tetrahydroquinazoline (CID 175263259) is 4,6,7,8-tetrahydroquinazoline.
What is the SMILES notation for 4,6,7,8-tetrahydroquinazoline?
The canonical SMILES for 4,6,7,8-tetrahydroquinazoline is C1=NCC2=CCCCC2=N1.
What is the InChIKey of 4,6,7,8-tetrahydroquinazoline?
The InChIKey is IOLPYJJNSQNNMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2/c1-2-4-8-7(3-1)5-9-6-10-8/h3,6H,1-2,4-5H2.
What are the key properties of 4,6,7,8-tetrahydroquinazoline?
4,6,7,8-tetrahydroquinazoline has a molecular weight of 134.18 g/mol, XLogP of 1.58, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,6,7,8-tetrahydroquinazoline is sourced from PubChem (CID 175263259), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).