C10H14N2 — CID 174588893
2,4-dimethyl-4,6,7,8-tetrahydroquinazoline (PubChem CID 174588893) has the molecular formula C10H14N2 and a molecular weight of 162.24 g/mol. Its IUPAC name is 2,4-dimethyl-4,6,7,8-tetrahydroquinazoline.
| Compound Name | 2,4-dimethyl-4,6,7,8-tetrahydroquinazoline |
|---|---|
| PubChem CID | 174588893 |
| Molecular Formula | C10H14N2 |
| Molecular Weight | 162.24 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | 2,4-dimethyl-4,6,7,8-tetrahydroquinazoline |
| SMILES | CC1=NC(C)C2=CCCCC2=N1 |
| InChI | InChI=1S/C10H14N2/c1-7-9-5-3-4-6-10(9)12-8(2)11-7/h5,7H,3-4,6H2,1-2H3 |
| InChIKey | IEWVMSRPPMCSMO-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.24 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |