C15H28N2Si — CID 123919894
N-[butan-2-yl(phenyl)silyl]-N',N'-diethylmethanediamine (PubChem CID 123919894) has the molecular formula C15H28N2Si and a molecular weight of 264.49 g/mol. Its IUPAC name is N-[butan-2-yl(phenyl)silyl]-N',N'-diethylmethanediamine.
| Compound Name | N-[butan-2-yl(phenyl)silyl]-N',N'-diethylmethanediamine |
|---|---|
| PubChem CID | 123919894 |
| Molecular Formula | C15H28N2Si |
| Molecular Weight | 264.49 g/mol |
| Exact Mass | 264.20 |
| IUPAC Name | N-[butan-2-yl(phenyl)silyl]-N',N'-diethylmethanediamine |
| SMILES | CCC(C)[SiH](NCN(CC)CC)c1ccccc1 |
| InChI | InChI=1S/C15H28N2Si/c1-5-14(4)18(15-11-9-8-10-12-15)16-13-17(6-2)7-3/h8-12,14,16,18H,5-7,13H2,1-4H3 |
| InChIKey | RYNZWQFFKWSOBH-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.49 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|