C13H22N2Si — CID 123951721
N-[ethenyl(phenyl)silyl]-N',N'-diethylmethanediamine (PubChem CID 123951721) has the molecular formula C13H22N2Si and a molecular weight of 234.42 g/mol. Its IUPAC name is N-[ethenyl(phenyl)silyl]-N',N'-diethylmethanediamine.
| Compound Name | N-[ethenyl(phenyl)silyl]-N',N'-diethylmethanediamine |
|---|---|
| PubChem CID | 123951721 |
| Molecular Formula | C13H22N2Si |
| Molecular Weight | 234.42 g/mol |
| Exact Mass | 234.16 |
| IUPAC Name | N-[ethenyl(phenyl)silyl]-N',N'-diethylmethanediamine |
| SMILES | C=C[SiH](NCN(CC)CC)c1ccccc1 |
| InChI | InChI=1S/C13H22N2Si/c1-4-15(5-2)12-14-16(6-3)13-10-8-7-9-11-13/h6-11,14,16H,3-5,12H2,1-2H3 |
| InChIKey | LWLQYRIJQCQVJA-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.42 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|