C16H29NSi — CID 123664729
N,N-diethyl-3-[phenyl(propan-2-yl)silyl]propan-1-amine (PubChem CID 123664729) has the molecular formula C16H29NSi and a molecular weight of 263.50 g/mol. Its IUPAC name is N,N-diethyl-3-[phenyl(propan-2-yl)silyl]propan-1-amine.
| Compound Name | N,N-diethyl-3-[phenyl(propan-2-yl)silyl]propan-1-amine |
|---|---|
| PubChem CID | 123664729 |
| Molecular Formula | C16H29NSi |
| Molecular Weight | 263.50 g/mol |
| Exact Mass | 263.21 |
| IUPAC Name | N,N-diethyl-3-[phenyl(propan-2-yl)silyl]propan-1-amine |
| SMILES | CCN(CC)CCC[SiH](c1ccccc1)C(C)C |
| InChI | InChI=1S/C16H29NSi/c1-5-17(6-2)13-10-14-18(15(3)4)16-11-8-7-9-12-16/h7-9,11-12,15,18H,5-6,10,13-14H2,1-4H3 |
| InChIKey | IAWWCVPMJCDBLL-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.50 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|