C14H18ClNO12P4S — CID 123920430
[(4-chlorophenyl)sulfanyl-[(1,1-diphosphono-2-pyridin-3-ylethoxy)-hydroxyphosphoryl]methyl]phosphonic acid (PubChem CID 123920430) has the molecular formula C14H18ClNO12P4S and a molecular weight of 583.71 g/mol. Its IUPAC name is [(4-chlorophenyl)sulfanyl-[(1,1-diphosphono-2-pyridin-3-ylethoxy)-hydroxyphosphoryl]methyl]phosphonic acid.
| Compound Name | [(4-chlorophenyl)sulfanyl-[(1,1-diphosphono-2-pyridin-3-ylethoxy)-hydroxyphosphoryl]methyl]phosphonic acid |
|---|---|
| PubChem CID | 123920430 |
| Molecular Formula | C14H18ClNO12P4S |
| Molecular Weight | 583.71 g/mol |
| Exact Mass | 582.92 |
| IUPAC Name | [(4-chlorophenyl)sulfanyl-[(1,1-diphosphono-2-pyridin-3-ylethoxy)-hydroxyphosphoryl]methyl]phosphonic acid |
| SMILES | O=P(O)(O)C(Sc1ccc(Cl)cc1)P(=O)(O)OC(Cc1cccnc1)(P(=O)(O)O)P(=O)(O)O |
| InChI | InChI=1S/C14H18ClNO12P4S/c15-11-3-5-12(6-4-11)33-13(29(17,18)19)30(20,21)28-14(31(22,23)24,32(25,26)27)8-10-2-1-7-16-9-10/h1-7,9,13H,8H2,(H,20,21)(H2,17,18,19)(H2,22,23,24)(H2,25,26,27) |
| InChIKey | SLDASZWAXHXXFC-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 232.01 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.71 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|