About 5-nitroso-3-[3-(trifluoromethoxy)phenyl]-2H-indeno[1,2-c]pyridazine
5-nitroso-3-[3-(trifluoromethoxy)phenyl]-2H-indeno[1,2-c]pyridazine (PubChem CID 1239237) has the molecular formula C18H10F3N3O2
and a molecular weight of 357.29 g/mol. Its IUPAC name is 5-nitroso-3-[3-(trifluoromethoxy)phenyl]-2H-indeno[1,2-c]pyridazine.
Molecular Properties
| Compound Name | 5-nitroso-3-[3-(trifluoromethoxy)phenyl]-2H-indeno[1,2-c]pyridazine |
| PubChem CID | 1239237 |
| Molecular Formula | C18H10F3N3O2 |
| Molecular Weight | 357.29 g/mol |
| Exact Mass | 357.07 |
| IUPAC Name | 5-nitroso-3-[3-(trifluoromethoxy)phenyl]-2H-indeno[1,2-c]pyridazine |
| SMILES | O=Nc1c2cc(-c3cccc(OC(F)(F)F)c3)[nH]nc-2c2ccccc12 |
| InChI | InChI=1S/C18H10F3N3O2/c19-18(20,21)26-11-5-3-4-10(8-11)15-9-14-16(23-22-15)12-6-1-2-7-13(12)17(14)24-25/h1-9,22H |
| InChIKey | ZWKSOWVUKMPAPM-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 67.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 357.29 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-nitroso-3-[3-(trifluoromethoxy)phenyl]-2H-indeno[1,2-c]pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-nitroso-3-[3-(trifluoromethoxy)phenyl]-2H-indeno[1,2-c]pyridazine?
The IUPAC name of 5-nitroso-3-[3-(trifluoromethoxy)phenyl]-2H-indeno[1,2-c]pyridazine (CID 1239237) is 5-nitroso-3-[3-(trifluoromethoxy)phenyl]-2H-indeno[1,2-c]pyridazine.
What is the SMILES notation for 5-nitroso-3-[3-(trifluoromethoxy)phenyl]-2H-indeno[1,2-c]pyridazine?
The canonical SMILES for 5-nitroso-3-[3-(trifluoromethoxy)phenyl]-2H-indeno[1,2-c]pyridazine is O=Nc1c2cc(-c3cccc(OC(F)(F)F)c3)[nH]nc-2c2ccccc12.
What is the InChIKey of 5-nitroso-3-[3-(trifluoromethoxy)phenyl]-2H-indeno[1,2-c]pyridazine?
The InChIKey is ZWKSOWVUKMPAPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H10F3N3O2/c19-18(20,21)26-11-5-3-4-10(8-11)15-9-14-16(23-22-15)12-6-1-2-7-13(12)17(14)24-25/h1-9,22H.
What are the key properties of 5-nitroso-3-[3-(trifluoromethoxy)phenyl]-2H-indeno[1,2-c]pyridazine?
5-nitroso-3-[3-(trifluoromethoxy)phenyl]-2H-indeno[1,2-c]pyridazine has a molecular weight of 357.29 g/mol, XLogP of 5.63, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-nitroso-3-[3-(trifluoromethoxy)phenyl]-2H-indeno[1,2-c]pyridazine is sourced from PubChem (CID 1239237), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).