C29H33F3N8O3 — CID 123924072
1-[3-[7-[1-[1-[2-(oxolan-2-yl)acetyl]piperidin-4-yl]pyrazol-4-yl]-7,8-dihydroimidazo[1,2-b]pyridazin-3-yl]phenyl]-3-(2,2,2-trifluoroethyl)urea (PubChem CID 123924072) has the molecular formula C29H33F3N8O3 and a molecular weight of 598.63 g/mol. Its IUPAC name is 1-[3-[7-[1-[1-[2-(oxolan-2-yl)acetyl]piperidin-4-yl]pyrazol-4-yl]-7,8-dihydroimidazo[1,2-b]pyridazin-3-yl]phenyl]-3-(2,2,2-trifluoroethyl)urea.
| Compound Name | 1-[3-[7-[1-[1-[2-(oxolan-2-yl)acetyl]piperidin-4-yl]pyrazol-4-yl]-7,8-dihydroimidazo[1,2-b]pyridazin-3-yl]phenyl]-3-(2,2,2-trifluoroethyl)urea |
|---|---|
| PubChem CID | 123924072 |
| Molecular Formula | C29H33F3N8O3 |
| Molecular Weight | 598.63 g/mol |
| Exact Mass | 598.26 |
| IUPAC Name | 1-[3-[7-[1-[1-[2-(oxolan-2-yl)acetyl]piperidin-4-yl]pyrazol-4-yl]-7,8-dihydroimidazo[1,2-b]pyridazin-3-yl]phenyl]-3-(2,2,2-trifluoroethyl)urea |
| SMILES | O=C(NCC(F)(F)F)Nc1cccc(-c2cnc3n2N=CC(c2cnn(C4CCN(C(=O)CC5CCCO5)CC4)c2)C3)c1 |
| InChI | InChI=1S/C29H33F3N8O3/c30-29(31,32)18-34-28(42)37-22-4-1-3-19(11-22)25-16-33-26-12-20(14-36-40(25)26)21-15-35-39(17-21)23-6-8-38(9-7-23)27(41)13-24-5-2-10-43-24/h1,3-4,11,14-17,20,23-24H,2,5-10,12-13,18H2,(H2,34,37,42) |
| InChIKey | LPVGVTNASKJTHW-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 118.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.63 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |