C14H17NO8 — CID 123924116
4-O-(2,5-dihydroxypyrrol-1-yl) 1-O-[2-(2-methylprop-2-enoyloxy)ethyl] butanedioate (PubChem CID 123924116) has the molecular formula C14H17NO8 and a molecular weight of 327.29 g/mol. Its IUPAC name is 4-O-(2,5-dihydroxypyrrol-1-yl) 1-O-[2-(2-methylprop-2-enoyloxy)ethyl] butanedioate.
| Compound Name | 4-O-(2,5-dihydroxypyrrol-1-yl) 1-O-[2-(2-methylprop-2-enoyloxy)ethyl] butanedioate |
|---|---|
| PubChem CID | 123924116 |
| Molecular Formula | C14H17NO8 |
| Molecular Weight | 327.29 g/mol |
| Exact Mass | 327.10 |
| IUPAC Name | 4-O-(2,5-dihydroxypyrrol-1-yl) 1-O-[2-(2-methylprop-2-enoyloxy)ethyl] butanedioate |
| SMILES | C=C(C)C(=O)OCCOC(=O)CCC(=O)On1c(O)ccc1O |
| InChI | InChI=1S/C14H17NO8/c1-9(2)14(20)22-8-7-21-12(18)5-6-13(19)23-15-10(16)3-4-11(15)17/h3-4,16-17H,1,5-8H2,2H3 |
| InChIKey | LEJXERXHLUTYOD-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.29 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|