C12H19N — CID 123927490
1,7-dimethyl-2,3,4,5,6,7-hexahydrocyclohepta[b]pyridine (PubChem CID 123927490) has the molecular formula C12H19N and a molecular weight of 177.29 g/mol. Its IUPAC name is 1,7-dimethyl-2,3,4,5,6,7-hexahydrocyclohepta[b]pyridine.
| Compound Name | 1,7-dimethyl-2,3,4,5,6,7-hexahydrocyclohepta[b]pyridine |
|---|---|
| PubChem CID | 123927490 |
| Molecular Formula | C12H19N |
| Molecular Weight | 177.29 g/mol |
| Exact Mass | 177.15 |
| IUPAC Name | 1,7-dimethyl-2,3,4,5,6,7-hexahydrocyclohepta[b]pyridine |
| SMILES | CC1C=CC2=C(CCCN2C)CC1 |
| InChI | InChI=1S/C12H19N/c1-10-5-7-11-4-3-9-13(2)12(11)8-6-10/h6,8,10H,3-5,7,9H2,1-2H3 |
| InChIKey | QUQDDYWZERVYSN-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.29 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |