C19H37N3O — CID 123927561
4-[1-(oxetan-3-yl)piperidin-4-yl]-1,5-dipropylpiperidin-3-amine (PubChem CID 123927561) has the molecular formula C19H37N3O and a molecular weight of 323.53 g/mol. Its IUPAC name is 4-[1-(oxetan-3-yl)piperidin-4-yl]-1,5-dipropylpiperidin-3-amine.
| Compound Name | 4-[1-(oxetan-3-yl)piperidin-4-yl]-1,5-dipropylpiperidin-3-amine |
|---|---|
| PubChem CID | 123927561 |
| Molecular Formula | C19H37N3O |
| Molecular Weight | 323.53 g/mol |
| Exact Mass | 323.29 |
| IUPAC Name | 4-[1-(oxetan-3-yl)piperidin-4-yl]-1,5-dipropylpiperidin-3-amine |
| SMILES | CCCC1CN(CCC)CC(N)C1C1CCN(C2COC2)CC1 |
| InChI | InChI=1S/C19H37N3O/c1-3-5-16-11-21(8-4-2)12-18(20)19(16)15-6-9-22(10-7-15)17-13-23-14-17/h15-19H,3-14,20H2,1-2H3 |
| InChIKey | NJNFQOTYWULKRJ-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 41.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.53 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |