C23H44N2O — CID 146558709
1-[2-methyl-5-[1-(oxetan-3-yl)piperidin-4-yl]hexan-2-yl]-4-propan-2-ylpiperidine (PubChem CID 146558709) has the molecular formula C23H44N2O and a molecular weight of 364.62 g/mol. Its IUPAC name is 1-[2-methyl-5-[1-(oxetan-3-yl)piperidin-4-yl]hexan-2-yl]-4-propan-2-ylpiperidine.
| Compound Name | 1-[2-methyl-5-[1-(oxetan-3-yl)piperidin-4-yl]hexan-2-yl]-4-propan-2-ylpiperidine |
|---|---|
| PubChem CID | 146558709 |
| Molecular Formula | C23H44N2O |
| Molecular Weight | 364.62 g/mol |
| Exact Mass | 364.35 |
| IUPAC Name | 1-[2-methyl-5-[1-(oxetan-3-yl)piperidin-4-yl]hexan-2-yl]-4-propan-2-ylpiperidine |
| SMILES | CC(C)C1CCN(C(C)(C)CCC(C)C2CCN(C3COC3)CC2)CC1 |
| InChI | InChI=1S/C23H44N2O/c1-18(2)20-9-14-25(15-10-20)23(4,5)11-6-19(3)21-7-12-24(13-8-21)22-16-26-17-22/h18-22H,6-17H2,1-5H3 |
| InChIKey | KLAWDIVCASRKNF-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.62 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |