C31H63N3O — CID 21359040
1-[2-[(2,6-diethyl-2,5,5-trimethyl-4-propylpiperidin-1-yl)methoxy]ethyl]-3,5-diethyl-2,2,3,4,5-pentamethylpiperazine (PubChem CID 21359040) has the molecular formula C31H63N3O and a molecular weight of 493.87 g/mol. Its IUPAC name is 1-[2-[(2,6-diethyl-2,5,5-trimethyl-4-propylpiperidin-1-yl)methoxy]ethyl]-3,5-diethyl-2,2,3,4,5-pentamethylpiperazine.
| Compound Name | 1-[2-[(2,6-diethyl-2,5,5-trimethyl-4-propylpiperidin-1-yl)methoxy]ethyl]-3,5-diethyl-2,2,3,4,5-pentamethylpiperazine |
|---|---|
| PubChem CID | 21359040 |
| Molecular Formula | C31H63N3O |
| Molecular Weight | 493.87 g/mol |
| Exact Mass | 493.50 |
| IUPAC Name | 1-[2-[(2,6-diethyl-2,5,5-trimethyl-4-propylpiperidin-1-yl)methoxy]ethyl]-3,5-diethyl-2,2,3,4,5-pentamethylpiperazine |
| SMILES | CCCC1CC(C)(CC)N(COCCN2CC(C)(CC)N(C)C(C)(CC)C2(C)C)C(CC)C1(C)C |
| InChI | InChI=1S/C31H63N3O/c1-14-19-25-22-29(10,16-3)34(26(15-2)27(25,6)7)24-35-21-20-33-23-30(11,17-4)32(13)31(12,18-5)28(33,8)9/h25-26H,14-24H2,1-13H3 |
| InChIKey | LOOXUEPSZJRPSL-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 18.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.87 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|