C31H32F2N6OS — CID 123928744
N-[6-(4,4-difluoropiperidin-1-yl)-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl]-3-[[4-[4-(methyliminomethyl)phenyl]imidazol-1-yl]methyl]benzamide (PubChem CID 123928744) has the molecular formula C31H32F2N6OS and a molecular weight of 574.70 g/mol. Its IUPAC name is N-[6-(4,4-difluoropiperidin-1-yl)-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl]-3-[[4-[4-(methyliminomethyl)phenyl]imidazol-1-yl]methyl]benzamide.
| Compound Name | N-[6-(4,4-difluoropiperidin-1-yl)-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl]-3-[[4-[4-(methyliminomethyl)phenyl]imidazol-1-yl]methyl]benzamide |
|---|---|
| PubChem CID | 123928744 |
| Molecular Formula | C31H32F2N6OS |
| Molecular Weight | 574.70 g/mol |
| Exact Mass | 574.23 |
| IUPAC Name | N-[6-(4,4-difluoropiperidin-1-yl)-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl]-3-[[4-[4-(methyliminomethyl)phenyl]imidazol-1-yl]methyl]benzamide |
| SMILES | C/N=C/c1ccc(-c2cn(Cc3cccc(C(=O)Nc4nc5c(s4)CC(N4CCC(F)(F)CC4)CC5)c3)cn2)cc1 |
| InChI | InChI=1S/C31H32F2N6OS/c1-34-17-21-5-7-23(8-6-21)27-19-38(20-35-27)18-22-3-2-4-24(15-22)29(40)37-30-36-26-10-9-25(16-28(26)41-30)39-13-11-31(32,33)12-14-39/h2-8,15,17,19-20,25H,9-14,16,18H2,1H3,(H,36,37,40)/b34-17+ |
| InChIKey | QHKAGIUMXGDOCT-KVAAJVFYSA-N |
| XLogP | 5.94 |
| TPSA | 75.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.70 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|