C16H28 — CID 123928843
1-ethyl-1-(2-methyl-3-propan-2-ylpenta-2,4-dienyl)cyclopentane (PubChem CID 123928843) has the molecular formula C16H28 and a molecular weight of 220.40 g/mol. Its IUPAC name is 1-ethyl-1-(2-methyl-3-propan-2-ylpenta-2,4-dienyl)cyclopentane.
| Compound Name | 1-ethyl-1-(2-methyl-3-propan-2-ylpenta-2,4-dienyl)cyclopentane |
|---|---|
| PubChem CID | 123928843 |
| Molecular Formula | C16H28 |
| Molecular Weight | 220.40 g/mol |
| Exact Mass | 220.22 |
| IUPAC Name | 1-ethyl-1-(2-methyl-3-propan-2-ylpenta-2,4-dienyl)cyclopentane |
| SMILES | C=CC(=C(C)CC1(CC)CCCC1)C(C)C |
| InChI | InChI=1S/C16H28/c1-6-15(13(3)4)14(5)12-16(7-2)10-8-9-11-16/h6,13H,1,7-12H2,2-5H3 |
| InChIKey | VWWARHFUBBVEHS-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.40 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|