C20H39N — CID 123930924
N-ethyl-6,9,11-trimethyl-9-propyldodec-11-en-2-imine (PubChem CID 123930924) has the molecular formula C20H39N and a molecular weight of 293.54 g/mol. Its IUPAC name is N-ethyl-6,9,11-trimethyl-9-propyldodec-11-en-2-imine.
| Compound Name | N-ethyl-6,9,11-trimethyl-9-propyldodec-11-en-2-imine |
|---|---|
| PubChem CID | 123930924 |
| Molecular Formula | C20H39N |
| Molecular Weight | 293.54 g/mol |
| Exact Mass | 293.31 |
| IUPAC Name | N-ethyl-6,9,11-trimethyl-9-propyldodec-11-en-2-imine |
| SMILES | C=C(C)CC(C)(CCC)CCC(C)CCC/C(C)=N/CC |
| InChI | InChI=1S/C20H39N/c1-8-14-20(7,16-17(3)4)15-13-18(5)11-10-12-19(6)21-9-2/h18H,3,8-16H2,1-2,4-7H3/b21-19+ |
| InChIKey | CZGHUVAPYLWGQW-XUTLUUPISA-N |
| XLogP | 6.83 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.54 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|