C9H11N3 — CID 123931148
N-[2-(1-methylpyrazol-4-yl)buta-1,3-dienyl]methanimine (PubChem CID 123931148) has the molecular formula C9H11N3 and a molecular weight of 161.21 g/mol. Its IUPAC name is N-[2-(1-methylpyrazol-4-yl)buta-1,3-dienyl]methanimine.
| Compound Name | N-[2-(1-methylpyrazol-4-yl)buta-1,3-dienyl]methanimine |
|---|---|
| PubChem CID | 123931148 |
| Molecular Formula | C9H11N3 |
| Molecular Weight | 161.21 g/mol |
| Exact Mass | 161.10 |
| IUPAC Name | N-[2-(1-methylpyrazol-4-yl)buta-1,3-dienyl]methanimine |
| SMILES | C=CC(=CN=C)c1cnn(C)c1 |
| InChI | InChI=1S/C9H11N3/c1-4-8(5-10-2)9-6-11-12(3)7-9/h4-7H,1-2H2,3H3 |
| InChIKey | NHSUCESQFHOXBZ-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 30.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.21 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|