C19H23ClN4O4Si — CID 123931462
2-[[2-chloro-5-methyl-4-(3-nitrophenoxy)pyrrolo[2,3-d]pyrimidin-7-yl]methoxy]ethyl-trimethylsilane (PubChem CID 123931462) has the molecular formula C19H23ClN4O4Si and a molecular weight of 434.96 g/mol. Its IUPAC name is 2-[[2-chloro-5-methyl-4-(3-nitrophenoxy)pyrrolo[2,3-d]pyrimidin-7-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[2-chloro-5-methyl-4-(3-nitrophenoxy)pyrrolo[2,3-d]pyrimidin-7-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 123931462 |
| Molecular Formula | C19H23ClN4O4Si |
| Molecular Weight | 434.96 g/mol |
| Exact Mass | 434.12 |
| IUPAC Name | 2-[[2-chloro-5-methyl-4-(3-nitrophenoxy)pyrrolo[2,3-d]pyrimidin-7-yl]methoxy]ethyl-trimethylsilane |
| SMILES | Cc1cn(COCC[Si](C)(C)C)c2nc(Cl)nc(Oc3cccc([N+](=O)[O-])c3)c12 |
| InChI | InChI=1S/C19H23ClN4O4Si/c1-13-11-23(12-27-8-9-29(2,3)4)17-16(13)18(22-19(20)21-17)28-15-7-5-6-14(10-15)24(25)26/h5-7,10-11H,8-9,12H2,1-4H3 |
| InChIKey | LHIDKDIKEQXANS-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 92.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.96 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|