C16H23NO — CID 123931760
3-[buta-1,3-dienyl(methyl)amino]-5,5-dimethyl-2-prop-1-en-2-ylcyclohex-2-en-1-one (PubChem CID 123931760) has the molecular formula C16H23NO and a molecular weight of 245.37 g/mol. Its IUPAC name is 3-[buta-1,3-dienyl(methyl)amino]-5,5-dimethyl-2-prop-1-en-2-ylcyclohex-2-en-1-one.
| Compound Name | 3-[buta-1,3-dienyl(methyl)amino]-5,5-dimethyl-2-prop-1-en-2-ylcyclohex-2-en-1-one |
|---|---|
| PubChem CID | 123931760 |
| Molecular Formula | C16H23NO |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.18 |
| IUPAC Name | 3-[buta-1,3-dienyl(methyl)amino]-5,5-dimethyl-2-prop-1-en-2-ylcyclohex-2-en-1-one |
| SMILES | C=CC=CN(C)C1=C(C(=C)C)C(=O)CC(C)(C)C1 |
| InChI | InChI=1S/C16H23NO/c1-7-8-9-17(6)13-10-16(4,5)11-14(18)15(13)12(2)3/h7-9H,1-2,10-11H2,3-6H3 |
| InChIKey | QHASDRUYEQNZPQ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|