C12H15N3Si — CID 123932620
5-isocyano-6-methyl-3-(2-trimethylsilylethynyl)pyridin-2-amine (PubChem CID 123932620) has the molecular formula C12H15N3Si and a molecular weight of 229.36 g/mol. Its IUPAC name is 5-isocyano-6-methyl-3-(2-trimethylsilylethynyl)pyridin-2-amine.
| Compound Name | 5-isocyano-6-methyl-3-(2-trimethylsilylethynyl)pyridin-2-amine |
|---|---|
| PubChem CID | 123932620 |
| Molecular Formula | C12H15N3Si |
| Molecular Weight | 229.36 g/mol |
| Exact Mass | 229.10 |
| IUPAC Name | 5-isocyano-6-methyl-3-(2-trimethylsilylethynyl)pyridin-2-amine |
| SMILES | [C-]#[N+]c1cc(C#C[Si](C)(C)C)c(N)nc1C |
| InChI | InChI=1S/C12H15N3Si/c1-9-11(14-2)8-10(12(13)15-9)6-7-16(3,4)5/h8H,1,3-5H3,(H2,13,15) |
| InChIKey | QRXGNFDHRAWRRT-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 43.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.36 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|