About 5-(3,3-dimethylbutyl)-2-hexan-2-ylspiro[2.2]pentane
5-(3,3-dimethylbutyl)-2-hexan-2-ylspiro[2.2]pentane (PubChem CID 123932635) has the molecular formula C17H32
and a molecular weight of 236.44 g/mol. Its IUPAC name is 5-(3,3-dimethylbutyl)-2-hexan-2-ylspiro[2.2]pentane.
Analyze 5-(3,3-dimethylbutyl)-2-hexan-2-ylspiro[2.2]pentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3,3-dimethylbutyl)-2-hexan-2-ylspiro[2.2]pentane?
The IUPAC name of 5-(3,3-dimethylbutyl)-2-hexan-2-ylspiro[2.2]pentane (CID 123932635) is 5-(3,3-dimethylbutyl)-2-hexan-2-ylspiro[2.2]pentane.
What is the SMILES notation for 5-(3,3-dimethylbutyl)-2-hexan-2-ylspiro[2.2]pentane?
The canonical SMILES for 5-(3,3-dimethylbutyl)-2-hexan-2-ylspiro[2.2]pentane is CCCCC(C)C1CC12CC2CCC(C)(C)C.
What is the InChIKey of 5-(3,3-dimethylbutyl)-2-hexan-2-ylspiro[2.2]pentane?
The InChIKey is IYHCUIFFVKDQCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H32/c1-6-7-8-13(2)15-12-17(15)11-14(17)9-10-16(3,4)5/h13-15H,6-12H2,1-5H3.
What are the key properties of 5-(3,3-dimethylbutyl)-2-hexan-2-ylspiro[2.2]pentane?
5-(3,3-dimethylbutyl)-2-hexan-2-ylspiro[2.2]pentane has a molecular weight of 236.44 g/mol, XLogP of 5.67, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3,3-dimethylbutyl)-2-hexan-2-ylspiro[2.2]pentane is sourced from PubChem (CID 123932635), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).