C19H12N4O3S2 — CID 123933657
2-(4-cyanophenyl)-4-(2,3-dihydro-1,2,3-benzothiadiazole-5-carbonylamino)thiophene-3-carboxylic acid (PubChem CID 123933657) has the molecular formula C19H12N4O3S2 and a molecular weight of 408.46 g/mol. Its IUPAC name is 2-(4-cyanophenyl)-4-(2,3-dihydro-1,2,3-benzothiadiazole-5-carbonylamino)thiophene-3-carboxylic acid.
| Compound Name | 2-(4-cyanophenyl)-4-(2,3-dihydro-1,2,3-benzothiadiazole-5-carbonylamino)thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 123933657 |
| Molecular Formula | C19H12N4O3S2 |
| Molecular Weight | 408.46 g/mol |
| Exact Mass | 408.04 |
| IUPAC Name | 2-(4-cyanophenyl)-4-(2,3-dihydro-1,2,3-benzothiadiazole-5-carbonylamino)thiophene-3-carboxylic acid |
| SMILES | N#Cc1ccc(-c2scc(NC(=O)c3ccc4c(c3)NNS4)c2C(=O)O)cc1 |
| InChI | InChI=1S/C19H12N4O3S2/c20-8-10-1-3-11(4-2-10)17-16(19(25)26)14(9-27-17)21-18(24)12-5-6-15-13(7-12)22-23-28-15/h1-7,9,22-23H,(H,21,24)(H,25,26) |
| InChIKey | BLXZDEDBMXTNPF-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 114.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.46 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|